CAS 1189657-00-8 is the registry number for Sodium Benzoylthioethanesulfonate-d4. Offered by: TRC. Available pack sizes: 50mg, 5mg.
Sodium 2-benzoylsulfanyl-1,1,2,2-tetradeuterioethanesulfonate (CAS 1189657-00-8) is a chemical compound with the molecular formula C9H9NaO4S2 and a molecular weight of 272.3 g/mol. IUPAC name: sodium 2-benzoylsulfanyl-1,1,2,2-tetradeuterioethanesulfonate. InChIKey: MQRJYFYHAKNZHS-FEUVXQGESA-M.
| Molecular formula | C9H9NaO4S2 |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | sodium 2-benzoylsulfanyl-1,1,2,2-tetradeuterioethanesulfonate |
| InChIKey | MQRJYFYHAKNZHS-FEUVXQGESA-M |
| SMILES | [2H]C([2H])(C([2H])([2H])S(=O)(=O)[O-])SC(=O)C1=CC=CC=C1.[Na+] |
Computed by PubChem (NCBI)