CAS 1189660-71-6 is the registry number for (4-Bromo-1-ethyl-1H-pyrazol-3-yl)piperazin-1-yl methanone hydrochloride. Offered by: Biosynth. Available pack sizes: 5000mg, 1000mg.
(4-bromo-1-ethylpyrazol-3-yl)-piperazin-1-ylmethanone;hydrochloride (CAS 1189660-71-6) is a chemical compound with the molecular formula C10H16BrClN4O and a molecular weight of 323.62 g/mol. IUPAC name: (4-bromo-1-ethylpyrazol-3-yl)-piperazin-1-ylmethanone;hydrochloride. InChIKey: IHMQNYDJAUAQNZ-UHFFFAOYSA-N.
| Molecular formula | C10H16BrClN4O |
|---|---|
| Molecular weight | 323.62 g/mol |
| IUPAC name | (4-bromo-1-ethylpyrazol-3-yl)-piperazin-1-ylmethanone;hydrochloride |
| InChIKey | IHMQNYDJAUAQNZ-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=N1)C(=O)N2CCNCC2)Br.Cl |
Computed by PubChem (NCBI)