CAS 1189661-61-7 is the registry number for 4-Fluorophenethyl Bromide-d4. Offered by: TRC. Available pack sizes: 250mg, 25mg.
1-(2-bromo-1,1,2,2-tetradeuterioethyl)-4-fluorobenzene (CAS 1189661-61-7) is a chemical compound with the molecular formula C8H8BrF and a molecular weight of 207.08 g/mol. IUPAC name: 1-(2-bromo-1,1,2,2-tetradeuterioethyl)-4-fluorobenzene. InChIKey: FLRUNCJXOVYWDH-NZLXMSDQSA-N.
| Molecular formula | C8H8BrF |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | 1-(2-bromo-1,1,2,2-tetradeuterioethyl)-4-fluorobenzene |
| InChIKey | FLRUNCJXOVYWDH-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)F)C([2H])([2H])Br |
Computed by PubChem (NCBI)