Products 1189678-43-0
CAS 1189678-43-0 appears in our catalog under these names: Flavoxate-d4 Hydrochloride, >95% (HPLC), Flavoxate-d4 hydrochloride, Flavoxate-d4 (hydrochloride). Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 10 mg, 1 mg.
(1,1,2,2-tetradeuterio-2-piperidin-1-ylethyl) 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride (CAS 1189678-43-0) is a chemical compound with the molecular formula C24H26ClNO4 and a molecular weight of 431.9 g/mol. IUPAC name: (1,1,2,2-tetradeuterio-2-piperidin-1-ylethyl) 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride. InChIKey: XOEVKNFZUQEERE-JWIOGAFXSA-N.
| Molecular formula | C24H26ClNO4 |
|---|---|
| Molecular weight | 431.9 g/mol |
| IUPAC name | (1,1,2,2-tetradeuterio-2-piperidin-1-ylethyl) 3-methyl-4-oxo-2-phenylchromene-8-carboxylate;hydrochloride |
| InChIKey | XOEVKNFZUQEERE-JWIOGAFXSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])OC(=O)C1=CC=CC2=C1OC(=C(C2=O)C)C3=CC=CC=C3)N4CCCCC4.Cl |
Computed by PubChem (NCBI)