Products 1189678-81-6
CAS 1189678-81-6 appears in our catalog under these names: Salicylic Acid-13C6, >95% (HPLC), Salicylic acid–13C6, Salicylic acid-13C6, 97.0%, Salicylic acid-13C6, 97%, Salicylic acid-(phenyl-13C6). Offered by: TRC, GLPBio, MedChemExpress, Chemat, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 1 mg, 5MG.
6-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid (CAS 1189678-81-6) is a chemical compound with the molecular formula C7H6O3 and a molecular weight of 144.077 g/mol. IUPAC name: 6-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid. InChIKey: YGSDEFSMJLZEOE-IDEBNGHGSA-N.
| Molecular formula | C7H6O3 |
|---|---|
| Molecular weight | 144.077 g/mol |
| IUPAC name | 6-hydroxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene-1-carboxylic acid |
| InChIKey | YGSDEFSMJLZEOE-IDEBNGHGSA-N |
| SMILES | [13CH]1=[13CH][13CH]=[13C]([13C](=[13CH]1)C(=O)O)O |
Computed by PubChem (NCBI)