CAS 1189685-28-6 appears in our catalog under these names: Sodium 4-(7-hydroxychroman-3-yl)phenyl sulfate, 97%, (R,S)-Equol 4’-Sulfate Sodium Salt (90%), (±)-Equol 4'-sulfate (sodium salt), (±)–Equol 4'–sulfate (sodium salt), R,S equol 4'-sulfate sodium salt. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 10mg, 1mg, 5mg, 2mg, 1 mg.
Sodium [4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] sulfate (CAS 1189685-28-6) is a chemical compound with the molecular formula C15H13NaO6S and a molecular weight of 344.3 g/mol. IUPAC name: sodium [4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] sulfate. InChIKey: VBXWXGINCBVVDO-UHFFFAOYSA-M.
| Molecular formula | C15H13NaO6S |
|---|---|
| Molecular weight | 344.3 g/mol |
| IUPAC name | sodium [4-(7-hydroxy-3,4-dihydro-2H-chromen-3-yl)phenyl] sulfate |
| InChIKey | VBXWXGINCBVVDO-UHFFFAOYSA-M |
| SMILES | C1C(COC2=C1C=CC(=C2)O)C3=CC=C(C=C3)OS(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)