Products 1189694-02-7
CAS 1189694-02-7 appears in our catalog under these names: 4'–Hydroxy Flurbiprofen–d3, 4’-Hydroxy Flurbiprofen-d3, 99.23%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 5mg, 1 mg, 5 mg.
3,3,3-trideuterio-2-[3-fluoro-4-(4-hydroxyphenyl)phenyl]propanoic acid (CAS 1189694-02-7) is a chemical compound with the molecular formula C15H13FO3 and a molecular weight of 263.28 g/mol. IUPAC name: 3,3,3-trideuterio-2-[3-fluoro-4-(4-hydroxyphenyl)phenyl]propanoic acid. InChIKey: GTSMMBJBNJDFRA-FIBGUPNXSA-N.
| Molecular formula | C15H13FO3 |
|---|---|
| Molecular weight | 263.28 g/mol |
| IUPAC name | 3,3,3-trideuterio-2-[3-fluoro-4-(4-hydroxyphenyl)phenyl]propanoic acid |
| InChIKey | GTSMMBJBNJDFRA-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(C1=CC(=C(C=C1)C2=CC=C(C=C2)O)F)C(=O)O |
Computed by PubChem (NCBI)