CAS 1189694-81-2 appears in our catalog under these names: Citalopram impurity 2 (hydrochloride), rac Didemethyl Citalopram Hydrochloride, >95% (HPLC). Offered by: MedChemExpress, TRC. Available pack sizes: Get quote, 2,5mg, 25mg.
1-(3-aminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrochloride (CAS 1189694-81-2) is a chemical compound with the molecular formula C18H18ClFN2O and a molecular weight of 332.8 g/mol. IUPAC name: 1-(3-aminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrochloride. InChIKey: ZPPDJHFUISDGTP-UHFFFAOYSA-N.
| Molecular formula | C18H18ClFN2O |
|---|---|
| Molecular weight | 332.8 g/mol |
| IUPAC name | 1-(3-aminopropyl)-1-(4-fluorophenyl)-3H-2-benzofuran-5-carbonitrile;hydrochloride |
| InChIKey | ZPPDJHFUISDGTP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(=C2)C#N)C(O1)(CCCN)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)