CAS 1189710-73-3 is the registry number for 4-Fluorophenylethanol-d4. Offered by: TRC. Available pack sizes: 500mg, 50mg.
1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethanol (CAS 1189710-73-3) is a chemical compound with the molecular formula C8H9FO and a molecular weight of 144.18 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethanol. InChIKey: MWUVGXCUHWKQJE-NZLXMSDQSA-N.
| Molecular formula | C8H9FO |
|---|---|
| Molecular weight | 144.18 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-(4-fluorophenyl)ethanol |
| InChIKey | MWUVGXCUHWKQJE-NZLXMSDQSA-N |
| SMILES | [2H]C([2H])(C1=CC=C(C=C1)F)C([2H])([2H])O |
Computed by PubChem (NCBI)