Products 1189723-14-5
CAS 1189723-14-5 is the registry number for 1-Methyl-4-oxopiperidine-d4. Offered by: MedChemExpress. Available pack sizes: 1 mg.
2,2,6,6-tetradeuterio-1-methylpiperidin-4-one (CAS 1189723-14-5) is a chemical compound with the molecular formula C6H11NO and a molecular weight of 117.18 g/mol. IUPAC name: 2,2,6,6-tetradeuterio-1-methylpiperidin-4-one. InChIKey: HUUPVABNAQUEJW-CQOLUAMGSA-N.
| Molecular formula | C6H11NO |
|---|---|
| Molecular weight | 117.18 g/mol |
| IUPAC name | 2,2,6,6-tetradeuterio-1-methylpiperidin-4-one |
| InChIKey | HUUPVABNAQUEJW-CQOLUAMGSA-N |
| SMILES | [2H]C1(CC(=O)CC(N1C)([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
1-Methyl-4-piperidone-2,2,6,6-d4, 2,2,6,6-tetradeuterio-1-methylpiperidin-4-one, 1-Methyl-4-oxopiperidine-d4, 3 - chloro - 5 - (trifluoroMethyl) benzene iodine, 1-Methyl(2,2,6,6-~2~H_4_)piperidin-4-one, 1-methyl(2,2,6,6-H)piperidin-4-one, 1-methyl(2,2,6,6-(2)H)piperidin-4-one, 2,2,6,6-tetradeuterio-1-methyl-piperidin-4-one