CAS 1189730-21-9 is the registry number for 1,2-Hydrazinedicarboxamide-13C2,15N2. Offered by: TRC. Available pack sizes: 50mg, 5mg.
(azanylcarbonylamino)(13C)urea (CAS 1189730-21-9) is a chemical compound with the molecular formula C2H6N4O2 and a molecular weight of 122.067 g/mol. IUPAC name: (azanylcarbonylamino)(13C)urea. InChIKey: ULUZGMIUTMRARO-JCDJMFQYSA-N.
| Molecular formula | C2H6N4O2 |
|---|---|
| Molecular weight | 122.067 g/mol |
| IUPAC name | (azanylcarbonylamino)(13C)urea |
| InChIKey | ULUZGMIUTMRARO-JCDJMFQYSA-N |
| SMILES | [13C](=O)([15NH2])NN[13C](=O)[15NH2] |
Computed by PubChem (NCBI)