Products 1189805-13-7
CAS 1189805-13-7 appears in our catalog under these names: Molindone-d8 HCl, Molindone-d8, >95% (HPLC), Molindone-d8, Molindone-d8, 99.2%. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 0,5mg.
3-ethyl-2-methyl-5-[(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]-1,5,6,7-tetrahydroindol-4-one (CAS 1189805-13-7) is a chemical compound with the molecular formula C16H24N2O2 and a molecular weight of 284.42 g/mol. IUPAC name: 3-ethyl-2-methyl-5-[(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]-1,5,6,7-tetrahydroindol-4-one. InChIKey: KLPWJLBORRMFGK-COMRDEPKSA-N.
| Molecular formula | C16H24N2O2 |
|---|---|
| Molecular weight | 284.42 g/mol |
| IUPAC name | 3-ethyl-2-methyl-5-[(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]-1,5,6,7-tetrahydroindol-4-one |
| InChIKey | KLPWJLBORRMFGK-COMRDEPKSA-N |
| SMILES | [2H]C1(C(OC(C(N1CC2CCC3=C(C2=O)C(=C(N3)C)CC)([2H])[2H])([2H])[2H])([2H])[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
Molindone-d8, Molindone D8