CAS 1189856-53-8 is the registry number for O-Desmethyl Pantoprazole O-Sulfate. Offered by: Chemat Brand. Available pack sizes: on request.
[2-[[6-(difluoromethoxy)-1H-benzimidazol-2-yl]sulfinylmethyl]-3-methoxy-4-pyridinyl] hydrogen sulfate (CAS 1189856-53-8) is a chemical compound with the molecular formula C15H13F2N3O7S2 and a molecular weight of 449.4 g/mol. IUPAC name: [2-[[6-(difluoromethoxy)-1H-benzimidazol-2-yl]sulfinylmethyl]-3-methoxy-4-pyridinyl] hydrogen sulfate. InChIKey: AQQVGUHYOGVLDA-UHFFFAOYSA-N.
| Molecular formula | C15H13F2N3O7S2 |
|---|---|
| Molecular weight | 449.4 g/mol |
| IUPAC name | [2-[[6-(difluoromethoxy)-1H-benzimidazol-2-yl]sulfinylmethyl]-3-methoxy-4-pyridinyl] hydrogen sulfate |
| InChIKey | AQQVGUHYOGVLDA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CN=C1CS(=O)C2=NC3=C(N2)C=C(C=C3)OC(F)F)OS(=O)(=O)O |
Computed by PubChem (NCBI)