CAS 1189858-48-7 is the registry number for 4-Chloro-N-(methyl-d3)pyridine-2-carboxamide, >95% (HPLC). Offered by: TRC. Available pack sizes: 50mg, 5mg.
4-chloro-N-(trideuteriomethyl)pyridine-2-carboxamide (CAS 1189858-48-7) is a chemical compound with the molecular formula C7H7ClN2O and a molecular weight of 173.61 g/mol. IUPAC name: 4-chloro-N-(trideuteriomethyl)pyridine-2-carboxamide. InChIKey: BGVBBMZMEKXUTR-FIBGUPNXSA-N.
| Molecular formula | C7H7ClN2O |
|---|---|
| Molecular weight | 173.61 g/mol |
| IUPAC name | 4-chloro-N-(trideuteriomethyl)pyridine-2-carboxamide |
| InChIKey | BGVBBMZMEKXUTR-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)C1=NC=CC(=C1)Cl |
Computed by PubChem (NCBI)