CAS 1189871-94-0 appears in our catalog under these names: N-Nitrososarcosine-d3, >95% (HPLC), N-Methyl-d3-N-nitrosoglycine, 99 atom % D, min 98% Chemical Purity, N–Nitroso Sarcosine–d3, 2-[Methyl(nitroso)amino]acetic acid-d3. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 50mg, 5mg, 0,01g, 0,005g, 1mg, 1 mg.
2-[nitroso(trideuteriomethyl)amino]acetic acid (CAS 1189871-94-0) is a chemical compound with the molecular formula C3H6N2O3 and a molecular weight of 121.11 g/mol. IUPAC name: 2-[nitroso(trideuteriomethyl)amino]acetic acid. InChIKey: HJMPSKKJHVWPBK-FIBGUPNXSA-N.
| Molecular formula | C3H6N2O3 |
|---|---|
| Molecular weight | 121.11 g/mol |
| IUPAC name | 2-[nitroso(trideuteriomethyl)amino]acetic acid |
| InChIKey | HJMPSKKJHVWPBK-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])N(CC(=O)O)N=O |
Computed by PubChem (NCBI)