CAS 1189874-88-1 is the registry number for 7-Chloro-5-(2-fluorophenyl)-2-methylamino-3H-1,4-benzodiazepine-13C1. Offered by: TRC. Available pack sizes: 100mg, 10mg.
7-chloro-5-(2-fluorophenyl)-N-methyl-1,3-dihydro-1,4-benzodiazepin-2-imine (CAS 1189874-88-1) is a chemical compound with the molecular formula C16H13ClFN3 and a molecular weight of 302.74 g/mol. IUPAC name: 7-chloro-5-(2-fluorophenyl)-N-methyl-1,3-dihydro-1,4-benzodiazepin-2-imine. InChIKey: HXBIKXSRZGPORM-XPOOIHDOSA-N.
| Molecular formula | C16H13ClFN3 |
|---|---|
| Molecular weight | 302.74 g/mol |
| IUPAC name | 7-chloro-5-(2-fluorophenyl)-N-methyl-1,3-dihydro-1,4-benzodiazepin-2-imine |
| InChIKey | HXBIKXSRZGPORM-XPOOIHDOSA-N |
| SMILES | CN=[13C]1CN=C(C2=C(N1)C=CC(=C2)Cl)C3=CC=CC=C3F |
Computed by PubChem (NCBI)