CAS 1189876-86-5 is the registry number for 1-Naphthalenemethanol-d7, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.
(2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methanol (CAS 1189876-86-5) is a chemical compound with the molecular formula C11H10O and a molecular weight of 165.24 g/mol. IUPAC name: (2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methanol. InChIKey: PBLNHHSDYFYZNC-GSNKEKJESA-N.
| Molecular formula | C11H10O |
|---|---|
| Molecular weight | 165.24 g/mol |
| IUPAC name | (2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl)methanol |
| InChIKey | PBLNHHSDYFYZNC-GSNKEKJESA-N |
| SMILES | [2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])[2H])CO)[2H])[2H] |
Computed by PubChem (NCBI)