CAS 1189881-28-4 appears in our catalog under these names: 2-(2-Aminoethoxy)anisole-d3, 2–(2–Aminoethoxy)anisole–d3. Offered by: TRC, GLPBio. Available pack sizes: 250mg, 25mg.
2-[2-(trideuteriomethoxy)phenoxy]ethanamine (CAS 1189881-28-4) is a chemical compound with the molecular formula C9H13NO2 and a molecular weight of 170.22 g/mol. IUPAC name: 2-[2-(trideuteriomethoxy)phenoxy]ethanamine. InChIKey: CKJRKLKVCHMWLV-FIBGUPNXSA-N.
| Molecular formula | C9H13NO2 |
|---|---|
| Molecular weight | 170.22 g/mol |
| IUPAC name | 2-[2-(trideuteriomethoxy)phenoxy]ethanamine |
| InChIKey | CKJRKLKVCHMWLV-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC=CC=C1OCCN |
Computed by PubChem (NCBI)