CAS 1189887-65-7 is the registry number for p-Fluoro Fentanyl-d3. Offered by: TRC. Available pack sizes: 10mg, 1mg.
3,3,3-trideuterio-N-(4-fluorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide (CAS 1189887-65-7) is a chemical compound with the molecular formula C22H27FN2O and a molecular weight of 357.5 g/mol. IUPAC name: 3,3,3-trideuterio-N-(4-fluorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide. InChIKey: KXUBAVLIJFTASZ-FIBGUPNXSA-N.
| Molecular formula | C22H27FN2O |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | 3,3,3-trideuterio-N-(4-fluorophenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| InChIKey | KXUBAVLIJFTASZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(=O)N(C1CCN(CC1)CCC2=CC=CC=C2)C3=CC=C(C=C3)F |
Computed by PubChem (NCBI)