CAS 1189888-77-4 appears in our catalog under these names: Clozapine EP Impurity C-d8 (N-Desmethyl Clozapine-d8), N-Desmethyl Clozapine-d8, >95% (HPLC), N–Desmethylclozapine–d8, N-Desmethyl clozapine-d8, N-Desmethylclozapine-d8, 98.73%. Offered by: Chemat Brand, TRC, GLPBio, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 500μg, 1 mg.
3-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine (CAS 1189888-77-4) is a chemical compound with the molecular formula C17H17ClN4 and a molecular weight of 320.8 g/mol. IUPAC name: 3-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine. InChIKey: JNNOSTQEZICQQP-UFBJYANTSA-N.
| Molecular formula | C17H17ClN4 |
|---|---|
| Molecular weight | 320.8 g/mol |
| IUPAC name | 3-chloro-6-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)-11H-benzo[b][1,4]benzodiazepine |
| InChIKey | JNNOSTQEZICQQP-UFBJYANTSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=C(C=CC(=C3)Cl)NC4=CC=CC=C42)([2H])[2H])[2H] |
Computed by PubChem (NCBI)