CAS 1189893-75-1 appears in our catalog under these names: Celecoxib Impurity 53, Methyl 4-(1-(4-sulfamoylphenyl)-3-(trifluoromethyl)-1H-pyrazol-5-yl)benzoate, 98%. Offered by: Hubei YoungXin, Chemat Brand. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, on request.
Methyl 4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate (CAS 1189893-75-1) is a chemical compound with the molecular formula C18H14F3N3O4S and a molecular weight of 425.4 g/mol. IUPAC name: methyl 4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate. InChIKey: AUACEYSPFQLYBF-UHFFFAOYSA-N.
| Molecular formula | C18H14F3N3O4S |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | methyl 4-[1-(4-sulfamoylphenyl)-3-(trifluoromethyl)pyrazol-5-yl]benzoate |
| InChIKey | AUACEYSPFQLYBF-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=CC(=NN2C3=CC=C(C=C3)S(=O)(=O)N)C(F)(F)F |
Computed by PubChem (NCBI)