Products 1189895-68-8
CAS 1189895-68-8 appears in our catalog under these names: 5-Aza Cytosine-15N4, >95% (HPLC), 5-Azacytosine-15N4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 500 μg, 5 mg, 1 mg.
6-(15N)azanyl-(1,3,5-15N3)1H-1,3,5-triazin-2-one (CAS 1189895-68-8) is a chemical compound with the molecular formula C3H4N4O and a molecular weight of 116.06 g/mol. IUPAC name: 6-(15N)azanyl-(1,3,5-15N3)1H-1,3,5-triazin-2-one. InChIKey: MFEFTTYGMZOIKO-SQLBHGNYSA-N.
| Molecular formula | C3H4N4O |
|---|---|
| Molecular weight | 116.06 g/mol |
| IUPAC name | 6-(15N)azanyl-(1,3,5-15N3)1H-1,3,5-triazin-2-one |
| InChIKey | MFEFTTYGMZOIKO-SQLBHGNYSA-N |
| SMILES | C1=[15N]C(=O)[15NH]C(=[15N]1)[15NH2] |
Computed by PubChem (NCBI)