Products 1189902-21-3
CAS 1189902-21-3 appears in our catalog under these names: Carbamazepine-d2 (Major), >95% (HPLC), Carbamazepine-d2. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 10 mg.
5,6-dideuteriobenzo[b][1]benzazepine-11-carboxamide (CAS 1189902-21-3) is a chemical compound with the molecular formula C15H12N2O and a molecular weight of 238.28 g/mol. IUPAC name: 5,6-dideuteriobenzo[b][1]benzazepine-11-carboxamide. InChIKey: FFGPTBGBLSHEPO-QDRJLNDYSA-N.
| Molecular formula | C15H12N2O |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 5,6-dideuteriobenzo[b][1]benzazepine-11-carboxamide |
| InChIKey | FFGPTBGBLSHEPO-QDRJLNDYSA-N |
| SMILES | [2H]C1=C(C2=CC=CC=C2N(C3=CC=CC=C13)C(=O)N)[2H] |
Computed by PubChem (NCBI)