CAS 1189904-01-5 appears in our catalog under these names: Acetazolamide D3, Acetazolamide-d3, Acetazolamide-d3, >95% (HPLC), Acetazolamide D3 (methyl D3), Acetazolamide-d3, 99.9%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5 mg, 1 mg, 1x5mg, 1x1ml.
2,2,2-trideuterio-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide (CAS 1189904-01-5) is a chemical compound with the molecular formula C4H6N4O3S2 and a molecular weight of 225.3 g/mol. IUPAC name: 2,2,2-trideuterio-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide. InChIKey: BZKPWHYZMXOIDC-FIBGUPNXSA-N.
| Molecular formula | C4H6N4O3S2 |
|---|---|
| Molecular weight | 225.3 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| InChIKey | BZKPWHYZMXOIDC-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC1=NN=C(S1)S(=O)(=O)N |
Computed by PubChem (NCBI)