CAS 1189919-69-4 is the registry number for 2-Butyl-d3-4-chloro-5-benzyloxymethyl-1H-imidazole. Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
4-chloro-5-(phenylmethoxymethyl)-2-(4,4,4-trideuteriobutyl)-1H-imidazole (CAS 1189919-69-4) is a chemical compound with the molecular formula C15H19ClN2O and a molecular weight of 281.79 g/mol. IUPAC name: 4-chloro-5-(phenylmethoxymethyl)-2-(4,4,4-trideuteriobutyl)-1H-imidazole. InChIKey: BPRFBRRGRCRQCZ-FIBGUPNXSA-N.
| Molecular formula | C15H19ClN2O |
|---|---|
| Molecular weight | 281.79 g/mol |
| IUPAC name | 4-chloro-5-(phenylmethoxymethyl)-2-(4,4,4-trideuteriobutyl)-1H-imidazole |
| InChIKey | BPRFBRRGRCRQCZ-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CCCC1=NC(=C(N1)COCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)