CAS 1189928-10-6 appears in our catalog under these names: Rhein-13C4, 98% 98%atom%13C, Rhein–13C4, Rhein-13C4. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, Get quote.
4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid (CAS 1189928-10-6) is a chemical compound with the molecular formula C15H8O6 and a molecular weight of 288.19 g/mol. IUPAC name: 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid. InChIKey: FCDLCPWAQCPTKC-AGPBJXDCSA-N.
| Molecular formula | C15H8O6 |
|---|---|
| Molecular weight | 288.19 g/mol |
| IUPAC name | 4,5-dihydroxy-9,10-dioxoanthracene-2-carboxylic acid |
| InChIKey | FCDLCPWAQCPTKC-AGPBJXDCSA-N |
| SMILES | C1=CC2=C(C(=C1)O)C(=O)C3=C(C2=O)[13CH]=C([13CH]=[13C]3O)[13C](=O)O |
Computed by PubChem (NCBI)