Products 1189928-38-8
CAS 1189928-38-8 appears in our catalog under these names: Trimebutine-d5, Trimebutine-d5 Fumarate. Offered by: TRC, Hubei YoungXin. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 200mg.
[3,3,4,4,4-pentadeuterio-2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate (CAS 1189928-38-8) is a chemical compound with the molecular formula C22H29NO5 and a molecular weight of 392.5 g/mol. IUPAC name: [3,3,4,4,4-pentadeuterio-2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate. InChIKey: LORDFXWUHHSAQU-WRMAMSRYSA-N.
| Molecular formula | C22H29NO5 |
|---|---|
| Molecular weight | 392.5 g/mol |
| IUPAC name | [3,3,4,4,4-pentadeuterio-2-(dimethylamino)-2-phenylbutyl] 3,4,5-trimethoxybenzoate |
| InChIKey | LORDFXWUHHSAQU-WRMAMSRYSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C(COC(=O)C1=CC(=C(C(=C1)OC)OC)OC)(C2=CC=CC=C2)N(C)C |
Computed by PubChem (NCBI)