CAS 1189942-73-1 appears in our catalog under these names: 1-Methoxy-2-(2-methoxyethoxy)ethane-d6, Diglyme-d6, >95% (GC). Offered by: MedChemExpress, TRC. Available pack sizes: 10 mg, 1 mg, 10mg, 1mg.
1-(trideuteriomethoxy)-2-[2-(trideuteriomethoxy)ethoxy]ethane (CAS 1189942-73-1) is a chemical compound with the molecular formula C6H14O3 and a molecular weight of 140.21 g/mol. IUPAC name: 1-(trideuteriomethoxy)-2-[2-(trideuteriomethoxy)ethoxy]ethane. InChIKey: SBZXBUIDTXKZTM-WFGJKAKNSA-N.
| Molecular formula | C6H14O3 |
|---|---|
| Molecular weight | 140.21 g/mol |
| IUPAC name | 1-(trideuteriomethoxy)-2-[2-(trideuteriomethoxy)ethoxy]ethane |
| InChIKey | SBZXBUIDTXKZTM-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])OCCOCCOC([2H])([2H])[2H] |
Computed by PubChem (NCBI)