Products 1189953-78-3
CAS 1189953-78-3 appears in our catalog under these names: Erlotinib-d6 HCl, Erlotinib-d6 Hydrochloride, >95% (HPLC), Erlotinib-d6 hydrochloride, Erlotinib–d6 (hydrochloride), Erlotinib-d6 (hydrochloride), 98.13%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 10 mg, 5 mg, 1 mg.
N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine;hydrochloride (CAS 1189953-78-3) is a chemical compound with the molecular formula C22H24ClN3O4 and a molecular weight of 435.9 g/mol. IUPAC name: N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine;hydrochloride. InChIKey: GTTBEUCJPZQMDZ-HVTBMTIBSA-N.
| Molecular formula | C22H24ClN3O4 |
|---|---|
| Molecular weight | 435.9 g/mol |
| IUPAC name | N-(3-ethynylphenyl)-6,7-bis[2-(trideuteriomethoxy)ethoxy]quinazolin-4-amine;hydrochloride |
| InChIKey | GTTBEUCJPZQMDZ-HVTBMTIBSA-N |
| SMILES | [2H]C([2H])([2H])OCCOC1=C(C=C2C(=C1)C(=NC=N2)NC3=CC=CC(=C3)C#C)OCCOC([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)