Products 1189965-47-6
CAS 1189965-47-6 is the registry number for Thiobutabarbital-d5. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 25mg, 10mg.
5-butan-2-yl-5-(1,1,2,2,2-pentadeuterioethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione (CAS 1189965-47-6) is a chemical compound with the molecular formula C10H16N2O2S and a molecular weight of 233.34 g/mol. IUPAC name: 5-butan-2-yl-5-(1,1,2,2,2-pentadeuterioethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione. InChIKey: IDELNEDBPWKHGK-ZTIZGVCASA-N.
| Molecular formula | C10H16N2O2S |
|---|---|
| Molecular weight | 233.34 g/mol |
| IUPAC name | 5-butan-2-yl-5-(1,1,2,2,2-pentadeuterioethyl)-2-sulfanylidene-1,3-diazinane-4,6-dione |
| InChIKey | IDELNEDBPWKHGK-ZTIZGVCASA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NC(=S)NC1=O)C(C)CC |
Computed by PubChem (NCBI)