CAS 1189968-85-1 is the registry number for 1-(4’-Methoxyphenyl)proanol-methyl-d3. Offered by: TRC. Available pack sizes: 500mg, 50mg.
3,3,3-trideuterio-1-(4-methoxyphenyl)propan-1-ol (CAS 1189968-85-1) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 169.23 g/mol. IUPAC name: 3,3,3-trideuterio-1-(4-methoxyphenyl)propan-1-ol. InChIKey: RELLLNVFFUWXHI-FIBGUPNXSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 169.23 g/mol |
| IUPAC name | 3,3,3-trideuterio-1-(4-methoxyphenyl)propan-1-ol |
| InChIKey | RELLLNVFFUWXHI-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])CC(C1=CC=C(C=C1)OC)O |
Computed by PubChem (NCBI)