CAS 1189969-31-0 appears in our catalog under these names: 3-Acetylthio-2-methylpropanoic Acid-d5, 3–Acetylthio–2–methylpropanoic Acid–d5, 3-(Acetylthio)-2-methylpropanoic acid-d5. Offered by: TRC, GLPBio, MedChemExpress. Available pack sizes: 100mg, 10mg, Get quote.
2-[acetylsulfanyl(dideuterio)methyl]-3,3,3-trideuteriopropanoic acid (CAS 1189969-31-0) is a chemical compound with the molecular formula C6H10O3S and a molecular weight of 167.24 g/mol. IUPAC name: 2-[acetylsulfanyl(dideuterio)methyl]-3,3,3-trideuteriopropanoic acid. InChIKey: VFVHNRJEYQGRGE-WNWXXORZSA-N.
| Molecular formula | C6H10O3S |
|---|---|
| Molecular weight | 167.24 g/mol |
| IUPAC name | 2-[acetylsulfanyl(dideuterio)methyl]-3,3,3-trideuteriopropanoic acid |
| InChIKey | VFVHNRJEYQGRGE-WNWXXORZSA-N |
| SMILES | [2H]C([2H])([2H])C(C(=O)O)C([2H])([2H])SC(=O)C |
Computed by PubChem (NCBI)