CAS 1189970-95-3 appears in our catalog under these names: Trimethoprim-13C3, 98% 98%atom%13C, Trimethoprim-13C3, 13C3-Trimethoprim, 13C3-Trimethoprim, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Chemat Brand, TRC, MedChemExpress, HPC Standards. Available pack sizes: on request, 0,5mg, 5mg, 500 μg, 1x10mg, 1x1ml.
5-[[3,4,5-tri((113C)methoxy)phenyl]methyl]pyrimidine-2,4-diamine (CAS 1189970-95-3) is a chemical compound with the molecular formula C14H18N4O3 and a molecular weight of 293.30 g/mol. IUPAC name: 5-[[3,4,5-tri((113C)methoxy)phenyl]methyl]pyrimidine-2,4-diamine. InChIKey: IEDVJHCEMCRBQM-VMIGTVKRSA-N.
| Molecular formula | C14H18N4O3 |
|---|---|
| Molecular weight | 293.30 g/mol |
| IUPAC name | 5-[[3,4,5-tri((113C)methoxy)phenyl]methyl]pyrimidine-2,4-diamine |
| InChIKey | IEDVJHCEMCRBQM-VMIGTVKRSA-N |
| SMILES | [13CH3]OC1=CC(=CC(=C1O[13CH3])O[13CH3])CC2=CN=C(N=C2N)N |
Computed by PubChem (NCBI)