Products 1189981-54-1
CAS 1189981-54-1 is the registry number for Mono-Ethyl Malonate-1,2,3-13C3. Offered by: TRC. Available pack sizes: 1mg, 5mg.
3-ethoxy-3-oxo(1,2,3-13C3)propanoic acid (CAS 1189981-54-1) is a chemical compound with the molecular formula C5H8O4 and a molecular weight of 135.09 g/mol. IUPAC name: 3-ethoxy-3-oxo(1,2,3-13C3)propanoic acid. InChIKey: HGINADPHJQTSKN-FRSWOAELSA-N.
| Molecular formula | C5H8O4 |
|---|---|
| Molecular weight | 135.09 g/mol |
| IUPAC name | 3-ethoxy-3-oxo(1,2,3-13C3)propanoic acid |
| InChIKey | HGINADPHJQTSKN-FRSWOAELSA-N |
| SMILES | CCO[13C](=O)[13CH2][13C](=O)O |
Computed by PubChem (NCBI)