CAS 119-20-0 appears in our catalog under these names: Calcium Levofolinate Impurity 5, rhizopterine, Rhizopterin. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, Get quote.
4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoic acid (CAS 119-20-0) is a chemical compound with the molecular formula C15H12N6O4 and a molecular weight of 340.29 g/mol. IUPAC name: 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoic acid. InChIKey: RCJIVJMTTMAMME-UHFFFAOYSA-N.
| Molecular formula | C15H12N6O4 |
|---|---|
| Molecular weight | 340.29 g/mol |
| IUPAC name | 4-[(2-amino-4-oxo-3H-pteridin-6-yl)methyl-formylamino]benzoic acid |
| InChIKey | RCJIVJMTTMAMME-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)O)N(CC2=CN=C3C(=N2)C(=O)NC(=N3)N)C=O |
Computed by PubChem (NCBI)