CAS 1190003-29-2 appears in our catalog under these names: Cyanazine-d5, >95% (HPLC), Cyanazine D5 (N-ethyl D5) 100 µg/mL in Acetone, Cyanazine-d5 (N-ethyl-d5), 99 atom % D, min 98% Chemical Purity, D5-Cyanazine, Concentration: 100 µg/ml Solvent: Acetone, Cyanazine-d5. Offered by: TRC, Dr. Ehrenstorfer, CDN, HPC Standards, MedChemExpress. Available pack sizes: 1mg, 5mg, 1ml, 0,01g, 0,005g, 1x1ml, 1 mg, 5 mg.
2-[[4-chloro-6-(1,1,2,2,2-pentadeuterioethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile (CAS 1190003-29-2) is a chemical compound with the molecular formula C9H13ClN6 and a molecular weight of 245.72 g/mol. IUPAC name: 2-[[4-chloro-6-(1,1,2,2,2-pentadeuterioethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile. InChIKey: MZZBPDKVEFVLFF-SGEUAGPISA-N.
| Molecular formula | C9H13ClN6 |
|---|---|
| Molecular weight | 245.72 g/mol |
| IUPAC name | 2-[[4-chloro-6-(1,1,2,2,2-pentadeuterioethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanenitrile |
| InChIKey | MZZBPDKVEFVLFF-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])NC1=NC(=NC(=N1)Cl)NC(C)(C)C#N |
Computed by PubChem (NCBI)