Products 1190005-72-1

CAS 1190005-72-1 is the registry number for 3-Pyridylacetic Acid-d6. Offered by: TRC. Available pack sizes: 50mg, 5mg.

Structural formula: {0} (CAS {1})

2,2-dideuterio-2-(2,4,5,6-tetradeuterio-3-pyridinyl)acetic acid (CAS 1190005-72-1) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 143.17 g/mol. IUPAC name: 2,2-dideuterio-2-(2,4,5,6-tetradeuterio-3-pyridinyl)acetic acid. InChIKey: WGNUNYPERJMVRM-KMHHPTQASA-N.

Identity
Molecular formulaC7H7NO2
Molecular weight143.17 g/mol
IUPAC name2,2-dideuterio-2-(2,4,5,6-tetradeuterio-3-pyridinyl)acetic acid
InChIKeyWGNUNYPERJMVRM-KMHHPTQASA-N
SMILES[2H]C1=C(C(=C(N=C1[2H])[2H])C([2H])([2H])C(=O)O)[2H]

Computed by PubChem (NCBI)