CAS 1190005-72-1 is the registry number for 3-Pyridylacetic Acid-d6. Offered by: TRC. Available pack sizes: 50mg, 5mg.
2,2-dideuterio-2-(2,4,5,6-tetradeuterio-3-pyridinyl)acetic acid (CAS 1190005-72-1) is a chemical compound with the molecular formula C7H7NO2 and a molecular weight of 143.17 g/mol. IUPAC name: 2,2-dideuterio-2-(2,4,5,6-tetradeuterio-3-pyridinyl)acetic acid. InChIKey: WGNUNYPERJMVRM-KMHHPTQASA-N.
| Molecular formula | C7H7NO2 |
|---|---|
| Molecular weight | 143.17 g/mol |
| IUPAC name | 2,2-dideuterio-2-(2,4,5,6-tetradeuterio-3-pyridinyl)acetic acid |
| InChIKey | WGNUNYPERJMVRM-KMHHPTQASA-N |
| SMILES | [2H]C1=C(C(=C(N=C1[2H])[2H])C([2H])([2H])C(=O)O)[2H] |
Computed by PubChem (NCBI)