Products 1190011-74-5

CAS 1190011-74-5 is the registry number for 2-(4-Methyl-1H-pyrazol-1-yl)acetyl chloride hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-(4-methylpyrazol-1-yl)acetyl chloride;hydrochloride (CAS 1190011-74-5) is a chemical compound with the molecular formula C6H8Cl2N2O and a molecular weight of 195.04 g/mol. IUPAC name: 2-(4-methylpyrazol-1-yl)acetyl chloride;hydrochloride. InChIKey: ZLRLGSGGCZJBLN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8Cl2N2O
Molecular weight195.04 g/mol
IUPAC name2-(4-methylpyrazol-1-yl)acetyl chloride;hydrochloride
InChIKeyZLRLGSGGCZJBLN-UHFFFAOYSA-N
SMILESCC1=CN(N=C1)CC(=O)Cl.Cl

Computed by PubChem (NCBI)