Products 1190021-40-9
CAS 1190021-40-9 is the registry number for Butyl resorcinol-d9. Offered by: Biosynth. Available pack sizes: 100mg.
3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)phenol (CAS 1190021-40-9) is a chemical compound with the molecular formula C10H14O2 and a molecular weight of 175.27 g/mol. IUPAC name: 3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)phenol. InChIKey: VGIJZDWQVCXVNL-AZOWHCDPSA-N.
| Molecular formula | C10H14O2 |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | 3-(1,1,2,2,3,3,4,4,4-nonadeuteriobutoxy)phenol |
| InChIKey | VGIJZDWQVCXVNL-AZOWHCDPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])OC1=CC=CC(=C1)O |
Computed by PubChem (NCBI)