Products 1190021-64-7
CAS 1190021-64-7 appears in our catalog under these names: Naratriptan D3 Hydrochloride, Naratriptan-d3 Hydrochloride, >95% (HPLC), Naratriptan-d3 (hydrochloride), 0.9965%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 1 mg.
N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide;hydrochloride (CAS 1190021-64-7) is a chemical compound with the molecular formula C17H26ClN3O2S and a molecular weight of 374.9 g/mol. IUPAC name: N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide;hydrochloride. InChIKey: AWEZYKMQFAUBTD-MUTAZJQDSA-N.
| Molecular formula | C17H26ClN3O2S |
|---|---|
| Molecular weight | 374.9 g/mol |
| IUPAC name | N-methyl-2-[3-[1-(trideuteriomethyl)piperidin-4-yl]-1H-indol-5-yl]ethanesulfonamide;hydrochloride |
| InChIKey | AWEZYKMQFAUBTD-MUTAZJQDSA-N |
| SMILES | [2H]C([2H])([2H])N1CCC(CC1)C2=CNC3=C2C=C(C=C3)CCS(=O)(=O)NC.Cl |
Computed by PubChem (NCBI)