CAS 1190095-08-9 appears in our catalog under these names: (2-Fluoro-5-((p-tolylamino)methyl)phenyl)boronic acid, 95%, (2–Fluoro–5–((p–tolylamino)methyl)phenyl)boronic acid, B-[2-Fluoro-5-[[(4-methylphenyl)amino]methyl]phenyl]boronic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 50mg.
[2-fluoro-5-[(4-methylanilino)methyl]phenyl]boronic acid (CAS 1190095-08-9) is a chemical compound with the molecular formula C14H15BFNO2 and a molecular weight of 259.09 g/mol. IUPAC name: [2-fluoro-5-[(4-methylanilino)methyl]phenyl]boronic acid. InChIKey: CEVNDBLSQXIRNX-UHFFFAOYSA-N.
| Molecular formula | C14H15BFNO2 |
|---|---|
| Molecular weight | 259.09 g/mol |
| IUPAC name | [2-fluoro-5-[(4-methylanilino)methyl]phenyl]boronic acid |
| InChIKey | CEVNDBLSQXIRNX-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CNC2=CC=C(C=C2)C)F)(O)O |
Computed by PubChem (NCBI)