CAS 1190102-74-9 is the registry number for 5-(4-Fluorophenyl)-3,4-dihydro-2h-1,4-thiazine-3-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-(4-fluorophenyl)-3,4-dihydro-2H-1,4-thiazine-3-carboxylic acid (CAS 1190102-74-9) is a chemical compound with the molecular formula C11H10FNO2S and a molecular weight of 239.27 g/mol. IUPAC name: 5-(4-fluorophenyl)-3,4-dihydro-2H-1,4-thiazine-3-carboxylic acid. InChIKey: HSZMBOXVDGPRRJ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2S |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 5-(4-fluorophenyl)-3,4-dihydro-2H-1,4-thiazine-3-carboxylic acid |
| InChIKey | HSZMBOXVDGPRRJ-UHFFFAOYSA-N |
| SMILES | C1C(NC(=CS1)C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)