Products 1190196-77-0
CAS 1190196-77-0 is the registry number for PMPMEase-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanesulfonyl fluoride (CAS 1190196-77-0) is a chemical compound with the molecular formula C17H29FO2S2 and a molecular weight of 348.5 g/mol. IUPAC name: 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanesulfonyl fluoride. InChIKey: RCEAZDGWMVLBPZ-BTMZFSHUSA-N.
| Molecular formula | C17H29FO2S2 |
|---|---|
| Molecular weight | 348.5 g/mol |
| IUPAC name | 2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienyl]sulfanylethanesulfonyl fluoride |
| InChIKey | RCEAZDGWMVLBPZ-BTMZFSHUSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CSCCS(=O)(=O)F)/C)/C)C |
Computed by PubChem (NCBI)