Products 1190197-97-7
CAS 1190197-97-7 appears in our catalog under these names: DLin-KC2-DMA/ 97.74% (existing batch purity), DLin-KC2-DMA, DLin-KC2-DMA, 99%, 99%, DLin-KC2-DMA, 99.88%, DLin-KC2-DMA, 99%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 1g.
2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylethanamine (CAS 1190197-97-7) is a chemical compound with the molecular formula C43H79NO2 and a molecular weight of 642.1 g/mol. IUPAC name: 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylethanamine. InChIKey: LRFJOIPOPUJUMI-KWXKLSQISA-N.
| Molecular formula | C43H79NO2 |
|---|---|
| Molecular weight | 642.1 g/mol |
| IUPAC name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]-N,N-dimethylethanamine |
| InChIKey | LRFJOIPOPUJUMI-KWXKLSQISA-N |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC1(OC(CO1)CCN(C)C)CCCCCCCC/C=C\C/C=C\CCCCC |
Computed by PubChem (NCBI)