Products 1190198-18-5

CAS 1190198-18-5 is the registry number for 2-(Benzylamino)-5-iodonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(benzylamino)-5-iodopyridine-3-carboxylic acid (CAS 1190198-18-5) is a chemical compound with the molecular formula C13H11IN2O2 and a molecular weight of 354.14 g/mol. IUPAC name: 2-(benzylamino)-5-iodopyridine-3-carboxylic acid. InChIKey: RJBSKVHDPIZBGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11IN2O2
Molecular weight354.14 g/mol
IUPAC name2-(benzylamino)-5-iodopyridine-3-carboxylic acid
InChIKeyRJBSKVHDPIZBGQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CNC2=C(C=C(C=N2)I)C(=O)O

Computed by PubChem (NCBI)