Products 1190319-33-5
CAS 1190319-33-5 is the registry number for 3-bromo-7-methoxy-1H-pyrrolo[3,2-b]pyridine, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-bromo-7-methoxy-1H-pyrrolo[3,2-b]pyridine (CAS 1190319-33-5) is a chemical compound with the molecular formula C8H7BrN2O and a molecular weight of 227.06 g/mol. IUPAC name: 3-bromo-7-methoxy-1H-pyrrolo[3,2-b]pyridine. InChIKey: VFGJKQZCIJWLQT-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN2O |
|---|---|
| Molecular weight | 227.06 g/mol |
| IUPAC name | 3-bromo-7-methoxy-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | VFGJKQZCIJWLQT-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=NC=C1)C(=CN2)Br |
Computed by PubChem (NCBI)