CAS 119043-16-2 appears in our catalog under these names: 4-(2-(((3-Ethyl-2,5-dihydro-4-methyl-2-oxo-1H-pyrrol-1-yl)carbonyl)amino)ethyl)benzenesulfonyl Chloride, Glimepiride Impurity 9. Offered by: TRC, Chemat Brand. Available pack sizes: 250mg, on request.
4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]benzenesulfonyl chloride (CAS 119043-16-2) is a chemical compound with the molecular formula C16H19ClN2O4S and a molecular weight of 370.9 g/mol. IUPAC name: 4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]benzenesulfonyl chloride. InChIKey: KEFLFSMLSAEGQB-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O4S |
|---|---|
| Molecular weight | 370.9 g/mol |
| IUPAC name | 4-[2-[(4-ethyl-3-methyl-5-oxo-2H-pyrrole-1-carbonyl)amino]ethyl]benzenesulfonyl chloride |
| InChIKey | KEFLFSMLSAEGQB-UHFFFAOYSA-N |
| SMILES | CCC1=C(CN(C1=O)C(=O)NCCC2=CC=C(C=C2)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)