CAS 119065-61-1 appears in our catalog under these names: Benidipine Impurity 6, (3R,4'S)-Benidipine HCl, Benidipine Impurity 3. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
5-O-[(3R)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (CAS 119065-61-1) is a chemical compound with the molecular formula C28H31N3O6 and a molecular weight of 505.6 g/mol. IUPAC name: 5-O-[(3R)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate. InChIKey: QZVNQOLPLYWLHQ-BVAGGSTKSA-N.
| Molecular formula | C28H31N3O6 |
|---|---|
| Molecular weight | 505.6 g/mol |
| IUPAC name | 5-O-[(3R)-1-benzylpiperidin-3-yl] 3-O-methyl (4S)-2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| InChIKey | QZVNQOLPLYWLHQ-BVAGGSTKSA-N |
| SMILES | CC1=C([C@@H](C(=C(N1)C)C(=O)O[C@@H]2CCCN(C2)CC3=CC=CC=C3)C4=CC(=CC=C4)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)