Products 119071-61-3
CAS 119071-61-3 is the registry number for 2-Fluoro-3,5-bis(trifluoromethyl)pyridine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-fluoro-3,5-bis(trifluoromethyl)pyridine (CAS 119071-61-3) is a chemical compound with the molecular formula C7H2F7N and a molecular weight of 233.09 g/mol. IUPAC name: 2-fluoro-3,5-bis(trifluoromethyl)pyridine. InChIKey: VGTZJUOUIJJLLY-UHFFFAOYSA-N.
| Molecular formula | C7H2F7N |
|---|---|
| Molecular weight | 233.09 g/mol |
| IUPAC name | 2-fluoro-3,5-bis(trifluoromethyl)pyridine |
| InChIKey | VGTZJUOUIJJLLY-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(F)(F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)