CAS 1190848-23-7 appears in our catalog under these names: Fluorobexarotene, Fluorobexarotene/ 99.23% (existing batch purity), 2-Fluoro-4-[1-(5,6,7,8-tetrahydro-3,5,5,8,8-pentamethyl-2-naphthalenyl)ethenyl]benzoic acid, Fluorobexarotene, 99.48%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 500mg, 1 mg.
2-fluoro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid (CAS 1190848-23-7) is a chemical compound with the molecular formula C24H27FO2 and a molecular weight of 366.5 g/mol. IUPAC name: 2-fluoro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid. InChIKey: LWKAWHRSPCHMPJ-UHFFFAOYSA-N.
| Molecular formula | C24H27FO2 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | 2-fluoro-4-[1-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)ethenyl]benzoic acid |
| InChIKey | LWKAWHRSPCHMPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C(=C)C3=CC(=C(C=C3)C(=O)O)F)C(CCC2(C)C)(C)C |
Computed by PubChem (NCBI)